C19H21N3O4S2 — CID 100719107
N-butyl-2-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]benzamide (PubChem CID 100719107) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-butyl-2-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]benzamide.
| Compound Name | N-butyl-2-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 100719107 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-butyl-2-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)sc(=O)n2C |
| InChI | InChI=1S/C19H21N3O4S2/c1-3-4-11-20-18(23)14-7-5-6-8-15(14)21-28(25,26)13-9-10-16-17(12-13)27-19(24)22(16)2/h5-10,12,21H,3-4,11H2,1-2H3,(H,20,23) |
| InChIKey | DKIYKZSIABIDSD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|