C17H16N2O5S — CID 110677114
1-ethyl-N-methyl-2,4-dioxo-N-phenyl-3,1-benzoxazine-6-sulfonamide (PubChem CID 110677114) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-ethyl-N-methyl-2,4-dioxo-N-phenyl-3,1-benzoxazine-6-sulfonamide.
| Compound Name | 1-ethyl-N-methyl-2,4-dioxo-N-phenyl-3,1-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 110677114 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-ethyl-N-methyl-2,4-dioxo-N-phenyl-3,1-benzoxazine-6-sulfonamide |
| SMILES | CCn1c(=O)oc(=O)c2cc(S(=O)(=O)N(C)c3ccccc3)ccc21 |
| InChI | InChI=1S/C17H16N2O5S/c1-3-19-15-10-9-13(11-14(15)16(20)24-17(19)21)25(22,23)18(2)12-7-5-4-6-8-12/h4-11H,3H2,1-2H3 |
| InChIKey | HCRLVECQKSSBIY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |