C18H15F3N2O3S — CID 22238936
N,1-dimethyl-2-oxo-N-phenyl-4-(trifluoromethyl)quinoline-6-sulfonamide (PubChem CID 22238936) has the molecular formula C18H15F3N2O3S and a molecular weight of 396.39 g/mol. Its IUPAC name is N,1-dimethyl-2-oxo-N-phenyl-4-(trifluoromethyl)quinoline-6-sulfonamide.
| Compound Name | N,1-dimethyl-2-oxo-N-phenyl-4-(trifluoromethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 22238936 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N,1-dimethyl-2-oxo-N-phenyl-4-(trifluoromethyl)quinoline-6-sulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc2c(c1)c(C(F)(F)F)cc(=O)n2C |
| InChI | InChI=1S/C18H15F3N2O3S/c1-22-16-9-8-13(10-14(16)15(11-17(22)24)18(19,20)21)27(25,26)23(2)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | YYVDGLLYMQUCPK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |