C22H24N5O2S+ — CID 25151978
2-[2-(4-aminopyridin-1-ium-1-yl)ethyl]-N,1-dimethyl-N-phenylbenzimidazole-5-sulfonamide (PubChem CID 25151978) has the molecular formula C22H24N5O2S+ and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[2-(4-aminopyridin-1-ium-1-yl)ethyl]-N,1-dimethyl-N-phenylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[2-(4-aminopyridin-1-ium-1-yl)ethyl]-N,1-dimethyl-N-phenylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 25151978 |
| Molecular Formula | C22H24N5O2S+ |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[2-(4-aminopyridin-1-ium-1-yl)ethyl]-N,1-dimethyl-N-phenylbenzimidazole-5-sulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc2c(c1)nc(CC[n+]1ccc(N)cc1)n2C |
| InChI | InChI=1S/C22H23N5O2S/c1-25-21-9-8-19(30(28,29)26(2)18-6-4-3-5-7-18)16-20(21)24-22(25)12-15-27-13-10-17(23)11-14-27/h3-11,13-14,16,23H,12,15H2,1-2H3/p+1 |
| InChIKey | OPUGVDSBTGMQMP-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|