C29H37N5O2S — CID 22621828
N-[2-[2-(4-aminophenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-[3-(diethylamino)propyl]benzenesulfonamide (PubChem CID 22621828) has the molecular formula C29H37N5O2S and a molecular weight of 519.72 g/mol. Its IUPAC name is N-[2-[2-(4-aminophenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-[3-(diethylamino)propyl]benzenesulfonamide.
| Compound Name | N-[2-[2-(4-aminophenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-[3-(diethylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22621828 |
| Molecular Formula | C29H37N5O2S |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | N-[2-[2-(4-aminophenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-[3-(diethylamino)propyl]benzenesulfonamide |
| SMILES | CCN(CC)CCCN(c1ccc2c(c1)nc(CCc1ccc(N)cc1)n2C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H37N5O2S/c1-4-33(5-2)20-9-21-34(37(35,36)26-10-7-6-8-11-26)25-17-18-28-27(22-25)31-29(32(28)3)19-14-23-12-15-24(30)16-13-23/h6-8,10-13,15-18,22H,4-5,9,14,19-21,30H2,1-3H3 |
| InChIKey | KUULNHJLYIFVQX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|