C33H44N6O2S — CID 18473762
4-[2-[5-[(4-tert-butylphenyl)sulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide (PubChem CID 18473762) has the molecular formula C33H44N6O2S and a molecular weight of 588.82 g/mol. Its IUPAC name is 4-[2-[5-[(4-tert-butylphenyl)sulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[5-[(4-tert-butylphenyl)sulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18473762 |
| Molecular Formula | C33H44N6O2S |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | 4-[2-[5-[(4-tert-butylphenyl)sulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(N(CCN(CC)CC)S(=O)(=O)c4ccc(C(C)(C)C)cc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C33H44N6O2S/c1-7-38(8-2)21-22-39(42(40,41)28-17-14-26(15-18-28)33(3,4)5)27-16-19-30-29(23-27)36-31(37(30)6)20-11-24-9-12-25(13-10-24)32(34)35/h9-10,12-19,23H,7-8,11,20-22H2,1-6H3,(H3,34,35) |
| InChIKey | JSRGSNPYYNXZDV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|