C28H29N5O3 — CID 15433217
4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoic acid (PubChem CID 15433217) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoic acid.
| Compound Name | 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoic acid |
|---|---|
| PubChem CID | 15433217 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCCC(=O)O)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C28H29N5O3/c1-32-24-15-14-21(28(36)33(17-5-8-26(34)35)22-6-3-2-4-7-22)18-23(24)31-25(32)16-11-19-9-12-20(13-10-19)27(29)30/h2-4,6-7,9-10,12-15,18H,5,8,11,16-17H2,1H3,(H3,29,30)(H,34,35) |
| InChIKey | XCAQCMPESPIAJQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|