C40H45N5O — CID 10121698
N-benzyl-3-(4-benzylcyclohexyl)-N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]propanamide (PubChem CID 10121698) has the molecular formula C40H45N5O and a molecular weight of 611.83 g/mol. Its IUPAC name is N-benzyl-3-(4-benzylcyclohexyl)-N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]propanamide.
| Compound Name | N-benzyl-3-(4-benzylcyclohexyl)-N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]propanamide |
|---|---|
| PubChem CID | 10121698 |
| Molecular Formula | C40H45N5O |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | N-benzyl-3-(4-benzylcyclohexyl)-N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]propanamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(N(Cc4ccccc4)C(=O)CCC4CCC(Cc5ccccc5)CC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C40H45N5O/c1-44-37-23-22-35(27-36(37)43-38(44)24-18-30-16-20-34(21-17-30)40(41)42)45(28-33-10-6-3-7-11-33)39(46)25-19-29-12-14-32(15-13-29)26-31-8-4-2-5-9-31/h2-11,16-17,20-23,27,29,32H,12-15,18-19,24-26,28H2,1H3,(H3,41,42) |
| InChIKey | MJOAQVMAYRLTPW-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|