C37H36ClN7O3 — CID 22450015
N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-2-ylmethyl)-2-[(4-nitrophenyl)methylamino]acetamide;hydrochloride (PubChem CID 22450015) has the molecular formula C37H36ClN7O3 and a molecular weight of 662.19 g/mol. Its IUPAC name is N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-2-ylmethyl)-2-[(4-nitrophenyl)methylamino]acetamide;hydrochloride.
| Compound Name | N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-2-ylmethyl)-2-[(4-nitrophenyl)methylamino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 22450015 |
| Molecular Formula | C37H36ClN7O3 |
| Molecular Weight | 662.19 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-2-ylmethyl)-2-[(4-nitrophenyl)methylamino]acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCc2nc3cc(N(Cc4ccc5ccccc5c4)C(=O)CNCc4ccc([N+](=O)[O-])cc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C37H35N7O3.ClH/c1-42-34-18-17-32(21-33(34)41-35(42)19-11-25-6-13-29(14-7-25)37(38)39)43(24-27-8-12-28-4-2-3-5-30(28)20-27)36(45)23-40-22-26-9-15-31(16-10-26)44(46)47;/h2-10,12-18,20-21,40H,11,19,22-24H2,1H3,(H3,38,39);1H |
| InChIKey | YINPDJRJZMIXBP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.19 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|