C25H26N6O — CID 141017050
N-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methyl]-N-methylbenzamide (PubChem CID 141017050) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methyl]-N-methylbenzamide.
| Compound Name | N-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 141017050 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methyl]-N-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2nc3cc(CN(C)C(=O)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C25H26N6O/c1-30(25(32)19-6-4-3-5-7-19)16-17-8-13-22-21(14-17)29-23(31(22)2)15-28-20-11-9-18(10-12-20)24(26)27/h3-14,28H,15-16H2,1-2H3,(H3,26,27) |
| InChIKey | LWAVZJUMCDELSL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|