C26H28ClN7O3 — CID 18412300
ethyl 2-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]acetate;hydrochloride (PubChem CID 18412300) has the molecular formula C26H28ClN7O3 and a molecular weight of 522.01 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]acetate;hydrochloride.
| Compound Name | ethyl 2-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]acetate;hydrochloride |
|---|---|
| PubChem CID | 18412300 |
| Molecular Formula | C26H28ClN7O3 |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | ethyl 2-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C26H27N7O3.ClH/c1-3-36-24(34)16-33(22-6-4-5-13-29-22)26(35)18-9-12-21-20(14-18)31-23(32(21)2)15-30-19-10-7-17(8-11-19)25(27)28;/h4-14,30H,3,15-16H2,1-2H3,(H3,27,28);1H |
| InChIKey | YQGYNYUCYDLQRZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|