C29H33N7O3 — CID 137497501
ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]pentanoate (PubChem CID 137497501) has the molecular formula C29H33N7O3 and a molecular weight of 527.63 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]pentanoate.
| Compound Name | ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]pentanoate |
|---|---|
| PubChem CID | 137497501 |
| Molecular Formula | C29H33N7O3 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]pentanoate |
| SMILES | [H]/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(c4ccccn4)C(CC)CC(=O)OCC)ccc3n2C)cc1 |
| InChI | InChI=1S/C29H33N7O3/c1-4-22(17-27(37)39-5-2)36(25-8-6-7-15-32-25)29(38)20-11-14-24-23(16-20)34-26(35(24)3)18-33-21-12-9-19(10-13-21)28(30)31/h6-16,22,33H,4-5,17-18H2,1-3H3,(H3,30,31) |
| InChIKey | OMBNQUUAXHCBIJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|