C27H29N7O4 — CID 10031681
ethyl 3-[[2-[[4-[(E)-N'-hydroxycarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 10031681) has the molecular formula C27H29N7O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-[(E)-N'-hydroxycarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-[(E)-N'-hydroxycarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 10031681 |
| Molecular Formula | C27H29N7O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | ethyl 3-[[2-[[4-[(E)-N'-hydroxycarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(/C(N)=N\O)cc1)n2C)c1ccccn1 |
| InChI | InChI=1S/C27H29N7O4/c1-3-38-25(35)13-15-34(23-6-4-5-14-29-23)27(36)19-9-12-22-21(16-19)31-24(33(22)2)17-30-20-10-7-18(8-11-20)26(28)32-37/h4-12,14,16,30,37H,3,13,15,17H2,1-2H3,(H2,28,32) |
| InChIKey | VMSJMFOJDKIVJZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 147.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|