C27H30ClN7O3 — CID 77174694
ethyl 3-[[2-[(4-methanehydrazonoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;hydrochloride (PubChem CID 77174694) has the molecular formula C27H30ClN7O3 and a molecular weight of 536.04 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-methanehydrazonoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[[2-[(4-methanehydrazonoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 77174694 |
| Molecular Formula | C27H30ClN7O3 |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | ethyl 3-[[2-[(4-methanehydrazonoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(C=NN)cc1)n2C)c1ccccn1.Cl |
| InChI | InChI=1S/C27H29N7O3.ClH/c1-3-37-26(35)13-15-34(24-6-4-5-14-29-24)27(36)20-9-12-23-22(16-20)32-25(33(23)2)18-30-21-10-7-19(8-11-21)17-31-28;/h4-12,14,16-17,30H,3,13,15,18,28H2,1-2H3;1H |
| InChIKey | ZXVFLYGWPSADBD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 127.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|