C34H41N7O4 — CID 89254323
ethyl 3-[[2-[[4-(N'-heptanoylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 89254323) has the molecular formula C34H41N7O4 and a molecular weight of 611.75 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-(N'-heptanoylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-(N'-heptanoylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 89254323 |
| Molecular Formula | C34H41N7O4 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | ethyl 3-[[2-[[4-(N'-heptanoylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCCC(=O)/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C34H41N7O4/c1-4-6-7-8-12-31(42)39-33(35)24-13-16-26(17-14-24)37-23-30-38-27-22-25(15-18-28(27)40(30)3)34(44)41(21-19-32(43)45-5-2)29-11-9-10-20-36-29/h9-11,13-18,20,22,37H,4-8,12,19,21,23H2,1-3H3,(H2,35,39,42) |
| InChIKey | ZPWIFPZEGZNSBZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 144.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|