C38H50N8O5 — CID 118882260
2-(diethylamino)ethyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 118882260) has the molecular formula C38H50N8O5 and a molecular weight of 698.87 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | 2-(diethylamino)ethyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 118882260 |
| Molecular Formula | C38H50N8O5 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.39 |
| IUPAC Name | 2-(diethylamino)ethyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCCOC(=O)/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCCN(CC)CC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C38H50N8O5/c1-5-8-9-12-24-51-38(49)43-36(39)28-14-17-30(18-15-28)41-27-34-42-31-26-29(16-19-32(31)44(34)4)37(48)46(33-13-10-11-21-40-33)22-20-35(47)50-25-23-45(6-2)7-3/h10-11,13-19,21,26,41H,5-9,12,20,22-25,27H2,1-4H3,(H2,39,43,49) |
| InChIKey | WLFPBLHMMMRSMC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 157.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|