C43H50N8O7 — CID 71626234
methyl 3-[[1-methyl-2-[[4-[(Z)-N'-[[4-(octoxycarbonylamino)phenyl]methoxycarbonyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 71626234) has the molecular formula C43H50N8O7 and a molecular weight of 790.92 g/mol. Its IUPAC name is methyl 3-[[1-methyl-2-[[4-[(Z)-N'-[[4-(octoxycarbonylamino)phenyl]methoxycarbonyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | methyl 3-[[1-methyl-2-[[4-[(Z)-N'-[[4-(octoxycarbonylamino)phenyl]methoxycarbonyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 71626234 |
| Molecular Formula | C43H50N8O7 |
| Molecular Weight | 790.92 g/mol |
| Exact Mass | 790.38 |
| IUPAC Name | methyl 3-[[1-methyl-2-[[4-[(Z)-N'-[[4-(octoxycarbonylamino)phenyl]methoxycarbonyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCCCCOC(=O)Nc1ccc(COC(=O)/N=C(\N)c2ccc(NCc3nc4cc(C(=O)N(CCC(=O)OC)c5ccccn5)ccc4n3C)cc2)cc1 |
| InChI | InChI=1S/C43H50N8O7/c1-4-5-6-7-8-11-26-57-42(54)47-34-18-13-30(14-19-34)29-58-43(55)49-40(44)31-15-20-33(21-16-31)46-28-38-48-35-27-32(17-22-36(35)50(38)2)41(53)51(25-23-39(52)56-3)37-12-9-10-24-45-37/h9-10,12-22,24,27,46H,4-8,11,23,25-26,28-29H2,1-3H3,(H,47,54)(H2,44,49,55) |
| InChIKey | DCDURGGKECQODE-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 192.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.92 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|