C41H49N9O5 — CID 71502865
(3,5,6-trimethylpyrazin-2-yl)methyl 3-[[2-[[4-[(Z)-N'-heptoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 71502865) has the molecular formula C41H49N9O5 and a molecular weight of 747.90 g/mol. Its IUPAC name is (3,5,6-trimethylpyrazin-2-yl)methyl 3-[[2-[[4-[(Z)-N'-heptoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | (3,5,6-trimethylpyrazin-2-yl)methyl 3-[[2-[[4-[(Z)-N'-heptoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 71502865 |
| Molecular Formula | C41H49N9O5 |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 747.39 |
| IUPAC Name | (3,5,6-trimethylpyrazin-2-yl)methyl 3-[[2-[[4-[(Z)-N'-heptoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCCCOC(=O)/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCc4nc(C)c(C)nc4C)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C41H49N9O5/c1-6-7-8-9-12-23-54-41(53)48-39(42)30-14-17-32(18-15-30)44-25-37-47-33-24-31(16-19-35(33)49(37)5)40(52)50(36-13-10-11-21-43-36)22-20-38(51)55-26-34-29(4)45-27(2)28(3)46-34/h10-11,13-19,21,24,44H,6-9,12,20,22-23,25-26H2,1-5H3,(H2,42,48,53) |
| InChIKey | AKXFVVDKVFZHSZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 179.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|