C32H37N7O6S — CID 145011639
ethyl 3-[[1-methyl-2-[[4-[(Z)-N'-(3-methylsulfinylpropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 145011639) has the molecular formula C32H37N7O6S and a molecular weight of 647.76 g/mol. Its IUPAC name is ethyl 3-[[1-methyl-2-[[4-[(Z)-N'-(3-methylsulfinylpropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[1-methyl-2-[[4-[(Z)-N'-(3-methylsulfinylpropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 145011639 |
| Molecular Formula | C32H37N7O6S |
| Molecular Weight | 647.76 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | ethyl 3-[[1-methyl-2-[[4-[(Z)-N'-(3-methylsulfinylpropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(/C(N)=N/C(=O)OCCCS(C)=O)cc1)n2C)c1ccccn1 |
| InChI | InChI=1S/C32H37N7O6S/c1-4-44-29(40)15-17-39(27-8-5-6-16-34-27)31(41)23-11-14-26-25(20-23)36-28(38(26)2)21-35-24-12-9-22(10-13-24)30(33)37-32(42)45-18-7-19-46(3)43/h5-6,8-14,16,20,35H,4,7,15,17-19,21H2,1-3H3,(H2,33,37,42) |
| InChIKey | MUKPLKQPOKHJCP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 171.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|