C41H53N7O7 — CID 163203137
ethyl 3-[[2-[[4-[(E)-N,N'-bis(hexoxycarbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 163203137) has the molecular formula C41H53N7O7 and a molecular weight of 755.92 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-[(E)-N,N'-bis(hexoxycarbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-[(E)-N,N'-bis(hexoxycarbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 163203137 |
| Molecular Formula | C41H53N7O7 |
| Molecular Weight | 755.92 g/mol |
| Exact Mass | 755.40 |
| IUPAC Name | ethyl 3-[[2-[[4-[(E)-N,N'-bis(hexoxycarbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCCOC(=O)/N=C(/NC(=O)OCCCCCC)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C41H53N7O7/c1-5-8-10-14-26-54-40(51)45-38(46-41(52)55-27-15-11-9-6-2)30-17-20-32(21-18-30)43-29-36-44-33-28-31(19-22-34(33)47(36)4)39(50)48(25-23-37(49)53-7-3)35-16-12-13-24-42-35/h12-13,16-22,24,28,43H,5-11,14-15,23,25-27,29H2,1-4H3,(H,45,46,51,52) |
| InChIKey | MYOQGSBXMRYIMO-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 166.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.92 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|