C39H52N7O6P — CID 145011641
ethyl 3-[[2-[[4-[(Z)-N'-[(Z)-1-(2-ethoxy-2-oxoethoxy)hex-1-enyl]carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;ethylphosphane (PubChem CID 145011641) has the molecular formula C39H52N7O6P and a molecular weight of 745.86 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-[(Z)-N'-[(Z)-1-(2-ethoxy-2-oxoethoxy)hex-1-enyl]carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;ethylphosphane.
| Compound Name | ethyl 3-[[2-[[4-[(Z)-N'-[(Z)-1-(2-ethoxy-2-oxoethoxy)hex-1-enyl]carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;ethylphosphane |
|---|---|
| PubChem CID | 145011641 |
| Molecular Formula | C39H52N7O6P |
| Molecular Weight | 745.86 g/mol |
| Exact Mass | 745.37 |
| IUPAC Name | ethyl 3-[[2-[[4-[(Z)-N'-[(Z)-1-(2-ethoxy-2-oxoethoxy)hex-1-enyl]carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;ethylphosphane |
| SMILES | CCCC/C=C(/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1)OCC(=O)OCC.CCP |
| InChI | InChI=1S/C37H45N7O6.C2H7P/c1-5-8-9-13-33(50-25-35(46)49-7-3)42-36(38)26-14-17-28(18-15-26)40-24-32-41-29-23-27(16-19-30(29)43(32)4)37(47)44(22-20-34(45)48-6-2)31-12-10-11-21-39-31;1-2-3/h10-19,21,23,40H,5-9,20,22,24-25H2,1-4H3,(H2,38,42);2-3H2,1H3/b33-13-; |
| InChIKey | GPZXYAULJLWGTF-KVXJBIKQSA-N |
| XLogP | 6.38 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.86 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|