C29H34Cl2N6O3 — CID 18412677
ethyl 4-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride (PubChem CID 18412677) has the molecular formula C29H34Cl2N6O3 and a molecular weight of 585.54 g/mol. Its IUPAC name is ethyl 4-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride.
| Compound Name | ethyl 4-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride |
|---|---|
| PubChem CID | 18412677 |
| Molecular Formula | C29H34Cl2N6O3 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | ethyl 4-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CCCC(=O)OCC)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C29H32N6O3.2ClH/c1-3-38-27(36)10-7-17-35(23-8-5-4-6-9-23)29(37)21-13-16-25-24(18-21)33-26(34(25)2)19-32-22-14-11-20(12-15-22)28(30)31;;/h4-6,8-9,11-16,18,32H,3,7,10,17,19H2,1-2H3,(H3,30,31);2*1H |
| InChIKey | FHBGAZMKVGAZJA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|