C29H33Cl2N5O3 — CID 18412610
methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride (PubChem CID 18412610) has the molecular formula C29H33Cl2N5O3 and a molecular weight of 570.52 g/mol. Its IUPAC name is methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride.
| Compound Name | methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride |
|---|---|
| PubChem CID | 18412610 |
| Molecular Formula | C29H33Cl2N5O3 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCCC(=O)OC)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C29H31N5O3.2ClH/c1-33-25-16-15-22(29(36)34(18-6-9-27(35)37-2)23-7-4-3-5-8-23)19-24(25)32-26(33)17-12-20-10-13-21(14-11-20)28(30)31;;/h3-5,7-8,10-11,13-16,19H,6,9,12,17-18H2,1-2H3,(H3,30,31);2*1H |
| InChIKey | FGJKCKFAMBEDDL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|