C26H31N5O3 — CID 18412505
3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoic acid (PubChem CID 18412505) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoic acid.
| Compound Name | 3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoic acid |
|---|---|
| PubChem CID | 18412505 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCC(=O)O)C4CCCC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C26H31N5O3/c1-30-22-12-11-19(26(34)31(15-14-24(32)33)20-4-2-3-5-20)16-21(22)29-23(30)13-8-17-6-9-18(10-7-17)25(27)28/h6-7,9-12,16,20H,2-5,8,13-15H2,1H3,(H3,27,28)(H,32,33) |
| InChIKey | LZKUOVURJFHONS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|