C23H30ClN5O2S — CID 158568271
4-[[5-[cyclohexyl(methylsulfonyl)amino]-1-methylbenzimidazol-2-yl]methyl]benzenecarboximidamide;hydrochloride (PubChem CID 158568271) has the molecular formula C23H30ClN5O2S and a molecular weight of 476.05 g/mol. Its IUPAC name is 4-[[5-[cyclohexyl(methylsulfonyl)amino]-1-methylbenzimidazol-2-yl]methyl]benzenecarboximidamide;hydrochloride.
| Compound Name | 4-[[5-[cyclohexyl(methylsulfonyl)amino]-1-methylbenzimidazol-2-yl]methyl]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 158568271 |
| Molecular Formula | C23H30ClN5O2S |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-[[5-[cyclohexyl(methylsulfonyl)amino]-1-methylbenzimidazol-2-yl]methyl]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(Cc2nc3cc(N(C4CCCCC4)S(C)(=O)=O)ccc3n2C)cc1 |
| InChI | InChI=1S/C23H29N5O2S.ClH/c1-27-21-13-12-19(28(31(2,29)30)18-6-4-3-5-7-18)15-20(21)26-22(27)14-16-8-10-17(11-9-16)23(24)25;/h8-13,15,18H,3-7,14H2,1-2H3,(H3,24,25);1H |
| InChIKey | HRTHNZCPJCTSQC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|