C29H37N5O3 — CID 23302416
ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexyl(methyl)carbamoyl]benzimidazol-1-yl]butanoate (PubChem CID 23302416) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexyl(methyl)carbamoyl]benzimidazol-1-yl]butanoate.
| Compound Name | ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexyl(methyl)carbamoyl]benzimidazol-1-yl]butanoate |
|---|---|
| PubChem CID | 23302416 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexyl(methyl)carbamoyl]benzimidazol-1-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(Cc2nc3cc(C(=O)N(C)C4CCCCC4)ccc3n2CCCC(=O)OCC)cc1 |
| InChI | InChI=1S/C29H37N5O3/c1-3-37-27(35)10-7-17-34-25-16-15-22(29(36)33(2)23-8-5-4-6-9-23)19-24(25)32-26(34)18-20-11-13-21(14-12-20)28(30)31/h11-16,19,23H,3-10,17-18H2,1-2H3,(H3,30,31) |
| InChIKey | ROINRLBXNMLSFY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|