C29H37N5O3 — CID 54198551
ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-(cyclohexylmethylcarbamoyl)benzimidazol-1-yl]butanoate (PubChem CID 54198551) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-(cyclohexylmethylcarbamoyl)benzimidazol-1-yl]butanoate.
| Compound Name | ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-(cyclohexylmethylcarbamoyl)benzimidazol-1-yl]butanoate |
|---|---|
| PubChem CID | 54198551 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | ethyl 4-[2-[(4-carbamimidoylphenyl)methyl]-5-(cyclohexylmethylcarbamoyl)benzimidazol-1-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(Cc2nc3cc(C(=O)NCC4CCCCC4)ccc3n2CCCC(=O)OCC)cc1 |
| InChI | InChI=1S/C29H37N5O3/c1-2-37-27(35)9-6-16-34-25-15-14-23(29(36)32-19-21-7-4-3-5-8-21)18-24(25)33-26(34)17-20-10-12-22(13-11-20)28(30)31/h10-15,18,21H,2-9,16-17,19H2,1H3,(H3,30,31)(H,32,36) |
| InChIKey | PNOMOFIUXODIEI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|