C28H40N6O2 — CID 18674347
N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide (PubChem CID 18674347) has the molecular formula C28H40N6O2 and a molecular weight of 492.67 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674347 |
| Molecular Formula | C28H40N6O2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)CCCC)ccc3n2CCCOCC)cc1 |
| InChI | InChI=1S/C28H40N6O2/c1-3-5-16-33(18-15-29)28(35)23-12-13-25-24(20-23)32-26(34(25)17-6-19-36-4-2)14-9-21-7-10-22(11-8-21)27(30)31/h7-8,10-13,20H,3-6,9,14-19,29H2,1-2H3,(H3,30,31) |
| InChIKey | NHZCTFOQPSQXDW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|