C34H45N7O — CID 70031915
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-decyl-N-pyridin-2-ylbenzimidazole-5-carboxamide (PubChem CID 70031915) has the molecular formula C34H45N7O and a molecular weight of 567.78 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-decyl-N-pyridin-2-ylbenzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-decyl-N-pyridin-2-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70031915 |
| Molecular Formula | C34H45N7O |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-decyl-N-pyridin-2-ylbenzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)c4ccccn4)ccc3n2CCCCCCCCCC)cc1 |
| InChI | InChI=1S/C34H45N7O/c1-2-3-4-5-6-7-8-11-23-40-30-19-18-28(34(42)41(24-21-35)31-12-9-10-22-38-31)25-29(30)39-32(40)20-15-26-13-16-27(17-14-26)33(36)37/h9-10,12-14,16-19,22,25H,2-8,11,15,20-21,23-24,35H2,1H3,(H3,36,37) |
| InChIKey | NEZNPXLZFRFKPF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|