C32H39N7O — CID 70033776
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-3-ylbenzimidazole-5-carboxamide (PubChem CID 70033776) has the molecular formula C32H39N7O and a molecular weight of 537.71 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-3-ylbenzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-3-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70033776 |
| Molecular Formula | C32H39N7O |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-3-ylbenzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)c4cccnc4)ccc3n2CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C32H39N7O/c33-17-20-38(27-7-4-18-36-22-27)32(40)26-13-14-29-28(21-26)37-30(39(29)19-16-23-5-2-1-3-6-23)15-10-24-8-11-25(12-9-24)31(34)35/h4,7-9,11-14,18,21-23H,1-3,5-6,10,15-17,19-20,33H2,(H3,34,35) |
| InChIKey | AAJHQZQFWSSVED-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|