C40H46N6O — CID 18674400
N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)benzimidazole-5-carboxamide (PubChem CID 18674400) has the molecular formula C40H46N6O and a molecular weight of 626.85 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)benzimidazole-5-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674400 |
| Molecular Formula | C40H46N6O |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.37 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(Cc4ccccc4)Cc4ccc(CN)cc4)ccc3n2CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C40H46N6O/c41-26-31-11-13-33(14-12-31)28-45(27-32-9-5-2-6-10-32)40(47)35-20-21-37-36(25-35)44-38(46(37)24-23-29-7-3-1-4-8-29)22-17-30-15-18-34(19-16-30)39(42)43/h2,5-6,9-16,18-21,25,29H,1,3-4,7-8,17,22-24,26-28,41H2,(H3,42,43) |
| InChIKey | ABULYPOEWKOPOR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|