C38H43N7O — CID 18674410
N-[[4-(aminomethyl)phenyl]methyl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-2-ylbenzimidazole-5-carboxamide (PubChem CID 18674410) has the molecular formula C38H43N7O and a molecular weight of 613.81 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-2-ylbenzimidazole-5-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-2-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674410 |
| Molecular Formula | C38H43N7O |
| Molecular Weight | 613.81 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(2-cyclohexylethyl)-N-pyridin-2-ylbenzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(Cc4ccc(CN)cc4)c4ccccn4)ccc3n2CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C38H43N7O/c39-25-29-9-11-30(12-10-29)26-45(35-8-4-5-22-42-35)38(46)32-18-19-34-33(24-32)43-36(44(34)23-21-27-6-2-1-3-7-27)20-15-28-13-16-31(17-14-28)37(40)41/h4-5,8-14,16-19,22,24,27H,1-3,6-7,15,20-21,23,25-26,39H2,(H3,40,41) |
| InChIKey | LYZHGKUPDBWAIB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.81 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|