C37H40N6O2 — CID 91301831
N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 91301831) has the molecular formula C37H40N6O2 and a molecular weight of 600.77 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 91301831 |
| Molecular Formula | C37H40N6O2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(Cc4ccccc4)Cc4ccc(CN)cc4)ccc3n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C37H40N6O2/c38-22-27-8-10-29(11-9-27)24-42(23-28-5-2-1-3-6-28)37(44)31-17-18-34-33(21-31)41-35(43(34)25-32-7-4-20-45-32)19-14-26-12-15-30(16-13-26)36(39)40/h1-3,5-6,8-13,15-18,21,32H,4,7,14,19-20,22-25,38H2,(H3,39,40) |
| InChIKey | IGISYSUCUXCEOM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|