C31H36N6O2 — CID 90757550
N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 90757550) has the molecular formula C31H36N6O2 and a molecular weight of 524.67 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90757550 |
| Molecular Formula | C31H36N6O2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)Cc4ccccc4)ccc3n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C31H36N6O2/c32-16-17-36(20-23-5-2-1-3-6-23)31(38)25-13-14-28-27(19-25)35-29(37(28)21-26-7-4-18-39-26)15-10-22-8-11-24(12-9-22)30(33)34/h1-3,5-6,8-9,11-14,19,26H,4,7,10,15-18,20-21,32H2,(H3,33,34) |
| InChIKey | VKDOGYUCZGPLOI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|