C33H33ClN6OS — CID 18674340
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(4-chlorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide (PubChem CID 18674340) has the molecular formula C33H33ClN6OS and a molecular weight of 597.19 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(4-chlorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(4-chlorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674340 |
| Molecular Formula | C33H33ClN6OS |
| Molecular Weight | 597.19 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(4-chlorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)Cc4ccc(Cl)cc4)ccc3n2CC2=CC=CCC2=S)cc1 |
| InChI | InChI=1S/C33H33ClN6OS/c34-27-13-7-23(8-14-27)20-39(18-17-35)33(41)25-12-15-29-28(19-25)38-31(40(29)21-26-3-1-2-4-30(26)42)16-9-22-5-10-24(11-6-22)32(36)37/h1-3,5-8,10-15,19H,4,9,16-18,20-21,35H2,(H3,36,37) |
| InChIKey | KANYUAXAAHDFGD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.19 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|