C33H33FN6OS — CID 18674393
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(2-fluorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide (PubChem CID 18674393) has the molecular formula C33H33FN6OS and a molecular weight of 580.73 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(2-fluorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(2-fluorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674393 |
| Molecular Formula | C33H33FN6OS |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-[(2-fluorophenyl)methyl]-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)Cc4ccccc4F)ccc3n2CC2=CC=CCC2=S)cc1 |
| InChI | InChI=1S/C33H33FN6OS/c34-27-7-3-1-5-25(27)20-39(18-17-35)33(41)24-14-15-29-28(19-24)38-31(40(29)21-26-6-2-4-8-30(26)42)16-11-22-9-12-23(13-10-22)32(36)37/h1-7,9-10,12-15,19H,8,11,16-18,20-21,35H2,(H3,36,37) |
| InChIKey | MJNFMGXSJNOKRO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|