C34H35ClN6O — CID 90910329
N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carboxamide (PubChem CID 90910329) has the molecular formula C34H35ClN6O and a molecular weight of 579.15 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90910329 |
| Molecular Formula | C34H35ClN6O |
| Molecular Weight | 579.15 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)Cc4ccccc4)ccc3n2CCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C34H35ClN6O/c35-29-14-8-25(9-15-29)18-20-41-31-16-13-28(34(42)40(21-19-36)23-26-4-2-1-3-5-26)22-30(31)39-32(41)17-10-24-6-11-27(12-7-24)33(37)38/h1-9,11-16,22H,10,17-21,23,36H2,(H3,37,38) |
| InChIKey | HFGDJGPEYJYICL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.15 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|