C32H32ClN7O — CID 90878994
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide (PubChem CID 90878994) has the molecular formula C32H32ClN7O and a molecular weight of 566.11 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90878994 |
| Molecular Formula | C32H32ClN7O |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)c4cccnc4)ccc3n2CCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H32ClN7O/c33-26-11-5-23(6-12-26)15-18-40-29-13-10-25(32(41)39(19-16-34)27-2-1-17-37-21-27)20-28(29)38-30(40)14-7-22-3-8-24(9-4-22)31(35)36/h1-6,8-13,17,20-21H,7,14-16,18-19,34H2,(H3,35,36) |
| InChIKey | MDBAWDXNGWUGAN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|