C34H42N6O — CID 18674294
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(cyclohexylmethyl)-1-(2-phenylethyl)benzimidazole-5-carboxamide (PubChem CID 18674294) has the molecular formula C34H42N6O and a molecular weight of 550.75 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(cyclohexylmethyl)-1-(2-phenylethyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(cyclohexylmethyl)-1-(2-phenylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674294 |
| Molecular Formula | C34H42N6O |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(cyclohexylmethyl)-1-(2-phenylethyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)CC4CCCCC4)ccc3n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H42N6O/c35-20-22-39(24-27-9-5-2-6-10-27)34(41)29-16-17-31-30(23-29)38-32(40(31)21-19-25-7-3-1-4-8-25)18-13-26-11-14-28(15-12-26)33(36)37/h1,3-4,7-8,11-12,14-17,23,27H,2,5-6,9-10,13,18-22,24,35H2,(H3,36,37) |
| InChIKey | DGHSMVCLEMWPMF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|