C36H37ClN6O3 — CID 91300773
methyl 4-[[2-aminoethyl-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carbonyl]amino]methyl]benzoate (PubChem CID 91300773) has the molecular formula C36H37ClN6O3 and a molecular weight of 637.18 g/mol. Its IUPAC name is methyl 4-[[2-aminoethyl-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[2-aminoethyl-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 91300773 |
| Molecular Formula | C36H37ClN6O3 |
| Molecular Weight | 637.18 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | methyl 4-[[2-aminoethyl-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]benzimidazole-5-carbonyl]amino]methyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)Cc4ccc(C(=O)OC)cc4)ccc3n2CCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C36H37ClN6O3/c1-46-36(45)28-11-4-26(5-12-28)23-42(21-19-38)35(44)29-13-16-32-31(22-29)41-33(17-8-24-2-9-27(10-3-24)34(39)40)43(32)20-18-25-6-14-30(37)15-7-25/h2-7,9-16,22H,8,17-21,23,38H2,1H3,(H3,39,40) |
| InChIKey | BFHSHIZEYRLXGZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.18 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|