C30H33N7O3 — CID 15516404
ethyl 2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-[(4-carbamimidoylphenyl)methyl]amino]acetate (PubChem CID 15516404) has the molecular formula C30H33N7O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-[(4-carbamimidoylphenyl)methyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-[(4-carbamimidoylphenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 15516404 |
| Molecular Formula | C30H33N7O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | ethyl 2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-[(4-carbamimidoylphenyl)methyl]amino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CC(=O)OCC)Cc4ccc(/C(N)=N/[H])cc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C30H33N7O3/c1-3-40-27(38)18-37(17-20-6-11-22(12-7-20)29(33)34)30(39)23-13-14-25-24(16-23)35-26(36(25)2)15-8-19-4-9-21(10-5-19)28(31)32/h4-7,9-14,16H,3,8,15,17-18H2,1-2H3,(H3,31,32)(H3,33,34) |
| InChIKey | OLWCWUPFYPIJNE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|