C25H28N6O3 — CID 18412721
ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-prop-2-ynylamino]propanoate (PubChem CID 18412721) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-prop-2-ynylamino]propanoate.
| Compound Name | ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-prop-2-ynylamino]propanoate |
|---|---|
| PubChem CID | 18412721 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-prop-2-ynylamino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CC#C)CCC(=O)OCC)ccc3n2C)cc1 |
| InChI | InChI=1S/C25H28N6O3/c1-4-13-31(14-12-23(32)34-5-2)25(33)18-8-11-21-20(15-18)29-22(30(21)3)16-28-19-9-6-17(7-10-19)24(26)27/h1,6-11,15,28H,5,12-14,16H2,2-3H3,(H3,26,27) |
| InChIKey | WULRHNVCDUKTDV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|