C29H31N5O3 — CID 18412611
methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate (PubChem CID 18412611) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate.
| Compound Name | methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate |
|---|---|
| PubChem CID | 18412611 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | methyl 4-(N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]anilino)butanoate |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCCC(=O)OC)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C29H31N5O3/c1-33-25-16-15-22(29(36)34(18-6-9-27(35)37-2)23-7-4-3-5-8-23)19-24(25)32-26(33)17-12-20-10-13-21(14-11-20)28(30)31/h3-5,7-8,10-11,13-16,19H,6,9,12,17-18H2,1-2H3,(H3,30,31) |
| InChIKey | CSESXPPXDOTWHJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|