C31H35N7O3 — CID 18674310
ethyl 3-(4-carbamimidoylphenyl)-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate (PubChem CID 18674310) has the molecular formula C31H35N7O3 and a molecular weight of 553.67 g/mol. Its IUPAC name is ethyl 3-(4-carbamimidoylphenyl)-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate.
| Compound Name | ethyl 3-(4-carbamimidoylphenyl)-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 18674310 |
| Molecular Formula | C31H35N7O3 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | ethyl 3-(4-carbamimidoylphenyl)-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(C)C(Cc4ccc(/C(N)=N/[H])cc4)C(=O)OCC)ccc3n2C)cc1 |
| InChI | InChI=1S/C31H35N7O3/c1-4-41-31(40)26(17-20-7-12-22(13-8-20)29(34)35)38(3)30(39)23-14-15-25-24(18-23)36-27(37(25)2)16-9-19-5-10-21(11-6-19)28(32)33/h5-8,10-15,18,26H,4,9,16-17H2,1-3H3,(H3,32,33)(H3,34,35) |
| InChIKey | GEBRWPYNSIDRMO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|