C26H32N6O4 — CID 15516421
6-acetamido-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]hexanoic acid (PubChem CID 15516421) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 6-acetamido-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]hexanoic acid.
| Compound Name | 6-acetamido-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 15516421 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 6-acetamido-2-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]hexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)NC(CCCCNC(C)=O)C(=O)O)ccc3n2C)cc1 |
| InChI | InChI=1S/C26H32N6O4/c1-16(33)29-14-4-3-5-20(26(35)36)31-25(34)19-11-12-22-21(15-19)30-23(32(22)2)13-8-17-6-9-18(10-7-17)24(27)28/h6-7,9-12,15,20H,3-5,8,13-14H2,1-2H3,(H3,27,28)(H,29,33)(H,31,34)(H,35,36) |
| InChIKey | ZINIOVJWTLBCHW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 163.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|