About 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid
2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid (PubChem CID 173248718) has the molecular formula C18H18N4O3
and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid |
| PubChem CID | 173248718 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid |
| SMILES | Cn1c(CCc2ccc(C(N)=NO)cc2)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C18H18N4O3/c1-22-15-8-7-13(18(23)24)10-14(15)20-16(22)9-4-11-2-5-12(6-3-11)17(19)21-25/h2-3,5-8,10,25H,4,9H2,1H3,(H2,19,21)(H,23,24) |
| InChIKey | MVZDIVYAHPWMPJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid?
The IUPAC name of 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid (CID 173248718) is 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid?
The canonical SMILES for 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid is Cn1c(CCc2ccc(C(N)=NO)cc2)nc2cc(C(=O)O)ccc21.
What is the InChIKey of 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid?
The InChIKey is MVZDIVYAHPWMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3/c1-22-15-8-7-13(18(23)24)10-14(15)20-16(22)9-4-11-2-5-12(6-3-11)17(19)21-25/h2-3,5-8,10,25H,4,9H2,1H3,(H2,19,21)(H,23,24).
What are the key properties of 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid?
2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid has a molecular weight of 338.37 g/mol, XLogP of 2.15, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid is sourced from PubChem (CID 173248718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).