C10H11ClN2O3 — CID 126810084
2-(hydroxymethyl)-1-methylbenzimidazole-5-carboxylic acid;hydrochloride (PubChem CID 126810084) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-methylbenzimidazole-5-carboxylic acid;hydrochloride.
| Compound Name | 2-(hydroxymethyl)-1-methylbenzimidazole-5-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 126810084 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(hydroxymethyl)-1-methylbenzimidazole-5-carboxylic acid;hydrochloride |
| SMILES | Cl.Cn1c(CO)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C10H10N2O3.ClH/c1-12-8-3-2-6(10(14)15)4-7(8)11-9(12)5-13;/h2-4,13H,5H2,1H3,(H,14,15);1H |
| InChIKey | VGMGFDBLTSGVQC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |