C25H30N4O4 — CID 172854906
2-[2-[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid (PubChem CID 172854906) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[2-[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[2-[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 172854906 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[2-[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]ethyl]-1-methylbenzimidazole-5-carboxylic acid |
| SMILES | [H]/N=C(\NC(=O)OCCCCCC)c1ccc(CCc2nc3cc(C(=O)O)ccc3n2C)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-3-4-5-6-15-33-25(32)28-23(26)18-10-7-17(8-11-18)9-14-22-27-20-16-19(24(30)31)12-13-21(20)29(22)2/h7-8,10-13,16H,3-6,9,14-15H2,1-2H3,(H,30,31)(H2,26,28,32) |
| InChIKey | YOHQTZXSCWXSLV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|