C34H39N7O6 — CID 175673449
ethyl 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 175673449) has the molecular formula C34H39N7O6 and a molecular weight of 641.73 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 175673449 |
| Molecular Formula | C34H39N7O6 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.30 |
| IUPAC Name | ethyl 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | [H]/N=C(\NC(=O)OCCCCCC)c1ccc(NC(=O)c2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C34H39N7O6/c1-4-6-7-10-21-47-34(45)39-30(35)23-12-15-25(16-13-23)37-32(43)31-38-26-22-24(14-17-27(26)40(31)3)33(44)41(20-18-29(42)46-5-2)28-11-8-9-19-36-28/h8-9,11-17,19,22H,4-7,10,18,20-21H2,1-3H3,(H,37,43)(H2,35,39,45) |
| InChIKey | FRQLNHHDHGJBIE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 168.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|