C36H44N6O5 — CID 144750064
hexyl (Z)-3-[4-[[5-[(3-ethoxy-3-oxopropyl)-pyridin-2-ylcarbamoyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]-3-(methylamino)prop-2-enoate (PubChem CID 144750064) has the molecular formula C36H44N6O5 and a molecular weight of 640.79 g/mol. Its IUPAC name is hexyl (Z)-3-[4-[[5-[(3-ethoxy-3-oxopropyl)-pyridin-2-ylcarbamoyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]-3-(methylamino)prop-2-enoate.
| Compound Name | hexyl (Z)-3-[4-[[5-[(3-ethoxy-3-oxopropyl)-pyridin-2-ylcarbamoyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]-3-(methylamino)prop-2-enoate |
|---|---|
| PubChem CID | 144750064 |
| Molecular Formula | C36H44N6O5 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | hexyl (Z)-3-[4-[[5-[(3-ethoxy-3-oxopropyl)-pyridin-2-ylcarbamoyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]-3-(methylamino)prop-2-enoate |
| SMILES | CCCCCCOC(=O)/C=C(\NC)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C36H44N6O5/c1-5-7-8-11-22-47-35(44)24-29(37-3)26-13-16-28(17-14-26)39-25-33-40-30-23-27(15-18-31(30)41(33)4)36(45)42(21-19-34(43)46-6-2)32-12-9-10-20-38-32/h9-10,12-18,20,23-24,37,39H,5-8,11,19,21-22,25H2,1-4H3/b29-24- |
| InChIKey | KHHQYYPKDAJBHQ-OLFWJLLRSA-N |
| XLogP | 5.86 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|